C13H10BrN3O6 — CID 135643926
2-[(Z)-2-(3-bromo-4-hydroxy-5-methoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 135643926) has the molecular formula C13H10BrN3O6 and a molecular weight of 384.14 g/mol. Its IUPAC name is 2-[(Z)-2-(3-bromo-4-hydroxy-5-methoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(Z)-2-(3-bromo-4-hydroxy-5-methoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135643926 |
| Molecular Formula | C13H10BrN3O6 |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2-[(Z)-2-(3-bromo-4-hydroxy-5-methoxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | COc1cc(/C=C\c2nc(O)c([N+](=O)[O-])c(=O)[nH]2)cc(Br)c1O |
| InChI | InChI=1S/C13H10BrN3O6/c1-23-8-5-6(4-7(14)11(8)18)2-3-9-15-12(19)10(17(21)22)13(20)16-9/h2-5,18H,1H3,(H2,15,16,19,20)/b3-2- |
| InChIKey | MUIXXXNIBQFUNR-IHWYPQMZSA-N |
| XLogP | 2.03 |
| TPSA | 138.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|