C14H12BrN3O6 — CID 137149899
2-[(Z)-2-(3-bromo-5-ethoxy-4-hydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 137149899) has the molecular formula C14H12BrN3O6 and a molecular weight of 398.17 g/mol. Its IUPAC name is 2-[(Z)-2-(3-bromo-5-ethoxy-4-hydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(Z)-2-(3-bromo-5-ethoxy-4-hydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137149899 |
| Molecular Formula | C14H12BrN3O6 |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 2-[(Z)-2-(3-bromo-5-ethoxy-4-hydroxyphenyl)ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(/C=C\c2nc(O)c([N+](=O)[O-])c(=O)[nH]2)cc(Br)c1O |
| InChI | InChI=1S/C14H12BrN3O6/c1-2-24-9-6-7(5-8(15)12(9)19)3-4-10-16-13(20)11(18(22)23)14(21)17-10/h3-6,19H,2H2,1H3,(H2,16,17,20,21)/b4-3- |
| InChIKey | SQWSSSMQDYHHLE-ARJAWSKDSA-N |
| XLogP | 2.42 |
| TPSA | 138.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|