C19H10BrF3N4O7 — CID 126344651
2-[(Z)-2-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one (PubChem CID 126344651) has the molecular formula C19H10BrF3N4O7 and a molecular weight of 543.21 g/mol. Its IUPAC name is 2-[(Z)-2-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-[(Z)-2-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 126344651 |
| Molecular Formula | C19H10BrF3N4O7 |
| Molecular Weight | 543.21 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 2-[(Z)-2-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(/C=C\c2cc(Br)ccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])nc(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H10BrF3N4O7/c20-11-3-5-13(34-14-4-2-10(19(21,22)23)8-12(14)26(30)31)9(7-11)1-6-15-24-17(28)16(27(32)33)18(29)25-15/h1-8H,(H2,24,25,28,29)/b6-1- |
| InChIKey | LFINHFWKQXUZOO-BHQIHCQQSA-N |
| XLogP | 5.04 |
| TPSA | 161.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.21 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|