C26H14BrF3N2O3 — CID 126326175
(E)-3-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-naphthalen-1-ylprop-2-enenitrile (PubChem CID 126326175) has the molecular formula C26H14BrF3N2O3 and a molecular weight of 539.31 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-naphthalen-1-ylprop-2-enenitrile.
| Compound Name | (E)-3-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-naphthalen-1-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 126326175 |
| Molecular Formula | C26H14BrF3N2O3 |
| Molecular Weight | 539.31 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | (E)-3-[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2-naphthalen-1-ylprop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(Br)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C26H14BrF3N2O3/c27-20-9-11-24(35-25-10-8-19(26(28,29)30)14-23(25)32(33)34)17(13-20)12-18(15-31)22-7-3-5-16-4-1-2-6-21(16)22/h1-14H/b18-12- |
| InChIKey | AZFOETIEZVTINI-PDGQHHTCSA-N |
| XLogP | 8.39 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.31 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|