C23H11BrClF3N2O5S — CID 126278750
(5Z)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126278750) has the molecular formula C23H11BrClF3N2O5S and a molecular weight of 599.77 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126278750 |
| Molecular Formula | C23H11BrClF3N2O5S |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 597.92 |
| IUPAC Name | (5Z)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cc(Br)ccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H11BrClF3N2O5S/c24-14-2-8-18(35-19-7-1-13(23(26,27)28)11-17(19)30(33)34)12(9-14)10-20-21(31)29(22(32)36-20)16-5-3-15(25)4-6-16/h1-11H/b20-10- |
| InChIKey | NKXABYBKAQOCLA-JMIUGGIZSA-N |
| XLogP | 8.06 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|