C23H9Br2Cl2F3N2O5S — CID 50870763
(5E)-5-[[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 50870763) has the molecular formula C23H9Br2Cl2F3N2O5S and a molecular weight of 713.11 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50870763 |
| Molecular Formula | C23H9Br2Cl2F3N2O5S |
| Molecular Weight | 713.11 g/mol |
| Exact Mass | 709.79 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-(3,4-dichlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cc(Br)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Br)c2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H9Br2Cl2F3N2O5S/c24-13-5-10(7-19-21(33)31(22(34)38-19)12-2-3-15(26)16(27)9-12)6-14(25)20(13)37-18-4-1-11(23(28,29)30)8-17(18)32(35)36/h1-9H/b19-7+ |
| InChIKey | WDVYVIZWDOKXJH-FBCYGCLPSA-N |
| XLogP | 9.48 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.11 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|