C19H11F3N4O7 — CID 126346298
4-hydroxy-5-nitro-2-[(Z)-2-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1H-pyrimidin-6-one (PubChem CID 126346298) has the molecular formula C19H11F3N4O7 and a molecular weight of 464.31 g/mol. Its IUPAC name is 4-hydroxy-5-nitro-2-[(Z)-2-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-nitro-2-[(Z)-2-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 126346298 |
| Molecular Formula | C19H11F3N4O7 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4-hydroxy-5-nitro-2-[(Z)-2-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]ethenyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(/C=C\c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)nc(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H11F3N4O7/c20-19(21,22)11-5-6-14(13(9-11)25(29)30)33-12-3-1-2-10(8-12)4-7-15-23-17(27)16(26(31)32)18(28)24-15/h1-9H,(H2,23,24,27,28)/b7-4- |
| InChIKey | RLOMSAMGUUUEKN-DAXSKMNVSA-N |
| XLogP | 4.27 |
| TPSA | 161.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|