C21H18N4O6 — CID 126344795
2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126344795) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126344795 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[4-[(E)-2-(4-hydroxy-5-nitro-6-oxo-1H-pyrimidin-2-yl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(/C=C/c2nc(O)c([N+](=O)[O-])c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H18N4O6/c1-13-4-2-3-5-16(13)22-18(26)12-31-15-9-6-14(7-10-15)8-11-17-23-20(27)19(25(29)30)21(28)24-17/h2-11H,12H2,1H3,(H,22,26)(H2,23,24,27,28)/b11-8+ |
| InChIKey | NVZNKIHQHXCUMT-DHZHZOJOSA-N |
| XLogP | 2.88 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|