C20H15Br2N3O5 — CID 126392586
6-[(E)-2-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 126392586) has the molecular formula C20H15Br2N3O5 and a molecular weight of 537.16 g/mol. Its IUPAC name is 6-[(E)-2-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(E)-2-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126392586 |
| Molecular Formula | C20H15Br2N3O5 |
| Molecular Weight | 537.16 g/mol |
| Exact Mass | 534.94 |
| IUPAC Name | 6-[(E)-2-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | Cc1ccc(COc2c(Br)cc(/C=C/c3[nH]c(=O)[nH]c(=O)c3[N+](=O)[O-])cc2Br)cc1 |
| InChI | InChI=1S/C20H15Br2N3O5/c1-11-2-4-12(5-3-11)10-30-18-14(21)8-13(9-15(18)22)6-7-16-17(25(28)29)19(26)24-20(27)23-16/h2-9H,10H2,1H3,(H2,23,24,26,27)/b7-6+ |
| InChIKey | JZIZEUNDYLYHTP-VOTSOKGWSA-N |
| XLogP | 4.55 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.16 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|