C21H15N5O6 — CID 126331362
5-nitro-6-[(E)-2-[1-[(4-nitrophenyl)methyl]indol-3-yl]ethenyl]-1H-pyrimidine-2,4-dione (PubChem CID 126331362) has the molecular formula C21H15N5O6 and a molecular weight of 433.38 g/mol. Its IUPAC name is 5-nitro-6-[(E)-2-[1-[(4-nitrophenyl)methyl]indol-3-yl]ethenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-nitro-6-[(E)-2-[1-[(4-nitrophenyl)methyl]indol-3-yl]ethenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126331362 |
| Molecular Formula | C21H15N5O6 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 5-nitro-6-[(E)-2-[1-[(4-nitrophenyl)methyl]indol-3-yl]ethenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(/C=C/c2cn(Cc3ccc([N+](=O)[O-])cc3)c3ccccc23)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C21H15N5O6/c27-20-19(26(31)32)17(22-21(28)23-20)10-7-14-12-24(18-4-2-1-3-16(14)18)11-13-5-8-15(9-6-13)25(29)30/h1-10,12H,11H2,(H2,22,23,27,28)/b10-7+ |
| InChIKey | XVTOUGBXDXLNTK-JXMROGBWSA-N |
| XLogP | 3.05 |
| TPSA | 156.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|