C25H17ClN4O4 — CID 126252642
(5E)-3-(4-chlorophenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126252642) has the molecular formula C25H17ClN4O4 and a molecular weight of 472.89 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126252642 |
| Molecular Formula | C25H17ClN4O4 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cn(Cc3ccc([N+](=O)[O-])cc3)c3ccccc23)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17ClN4O4/c26-18-7-11-19(12-8-18)29-24(31)22(27-25(29)32)13-17-15-28(23-4-2-1-3-21(17)23)14-16-5-9-20(10-6-16)30(33)34/h1-13,15H,14H2,(H,27,32)/b22-13+ |
| InChIKey | IUAPFLJJALMHDC-LPYMAVHISA-N |
| XLogP | 5.35 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|