C19H13N3O4S — CID 67698541
4-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,5-dione (PubChem CID 67698541) has the molecular formula C19H13N3O4S and a molecular weight of 379.40 g/mol. Its IUPAC name is 4-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67698541 |
| Molecular Formula | C19H13N3O4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(=Cc2cn(Cc3ccc([N+](=O)[O-])cc3)c3ccccc23)C(=O)S1 |
| InChI | InChI=1S/C19H13N3O4S/c23-18-16(20-19(24)27-18)9-13-11-21(17-4-2-1-3-15(13)17)10-12-5-7-14(8-6-12)22(25)26/h1-9,11H,10H2,(H,20,24) |
| InChIKey | XCMOAUPKQHIZRN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|