C19H14N4O4 — CID 45138065
(5Z)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 45138065) has the molecular formula C19H14N4O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is (5Z)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45138065 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (5Z)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cn(Cc3ccc([N+](=O)[O-])cc3)c3ccccc23)N1 |
| InChI | InChI=1S/C19H14N4O4/c24-18-16(20-19(25)21-18)9-13-11-22(17-4-2-1-3-15(13)17)10-12-5-7-14(8-6-12)23(26)27/h1-9,11H,10H2,(H2,20,21,24,25)/b16-9- |
| InChIKey | NQPSWIKWJRPNPV-SXGWCWSVSA-N |
| XLogP | 2.78 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|