C27H20N4O5S — CID 126180702
(5E)-1-(2-methoxyphenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126180702) has the molecular formula C27H20N4O5S and a molecular weight of 512.55 g/mol. Its IUPAC name is (5E)-1-(2-methoxyphenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(2-methoxyphenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126180702 |
| Molecular Formula | C27H20N4O5S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (5E)-1-(2-methoxyphenyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccccc1N1C(=O)/C(=C/c2cn(Cc3ccc([N+](=O)[O-])cc3)c3ccccc23)C(=O)NC1=S |
| InChI | InChI=1S/C27H20N4O5S/c1-36-24-9-5-4-8-23(24)30-26(33)21(25(32)28-27(30)37)14-18-16-29(22-7-3-2-6-20(18)22)15-17-10-12-19(13-11-17)31(34)35/h2-14,16H,15H2,1H3,(H,28,32,37)/b21-14+ |
| InChIKey | SVPDQAPZXPIMIS-KGENOOAVSA-N |
| XLogP | 4.44 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|