C27H19ClN4O4S — CID 126240851
(5E)-1-(3-chloro-4-methylphenyl)-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126240851) has the molecular formula C27H19ClN4O4S and a molecular weight of 530.99 g/mol. Its IUPAC name is (5E)-1-(3-chloro-4-methylphenyl)-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(3-chloro-4-methylphenyl)-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126240851 |
| Molecular Formula | C27H19ClN4O4S |
| Molecular Weight | 530.99 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | (5E)-1-(3-chloro-4-methylphenyl)-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3cn(Cc4cccc([N+](=O)[O-])c4)c4ccccc34)C(=O)NC2=S)cc1Cl |
| InChI | InChI=1S/C27H19ClN4O4S/c1-16-9-10-19(13-23(16)28)31-26(34)22(25(33)29-27(31)37)12-18-15-30(24-8-3-2-7-21(18)24)14-17-5-4-6-20(11-17)32(35)36/h2-13,15H,14H2,1H3,(H,29,33,37)/b22-12+ |
| InChIKey | OPSSNRSYEDNFGB-WSDLNYQXSA-N |
| XLogP | 5.39 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.99 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|