C22H21N5O5S — CID 66522283
(5Z)-1-(2-methoxyphenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 66522283) has the molecular formula C22H21N5O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is (5Z)-1-(2-methoxyphenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-1-(2-methoxyphenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 66522283 |
| Molecular Formula | C22H21N5O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (5Z)-1-(2-methoxyphenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccccc1N1C(=O)/C(=C\c2cc([N+](=O)[O-])ccc2N2CCNCC2)C(=O)NC1=S |
| InChI | InChI=1S/C22H21N5O5S/c1-32-19-5-3-2-4-18(19)26-21(29)16(20(28)24-22(26)33)13-14-12-15(27(30)31)6-7-17(14)25-10-8-23-9-11-25/h2-7,12-13,23H,8-11H2,1H3,(H,24,28,33)/b16-13- |
| InChIKey | MLTOYGNRQUFUEY-SSZFMOIBSA-N |
| XLogP | 1.84 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|