C21H18ClN5O5 — CID 66522422
(5Z)-1-(3-chlorophenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 66522422) has the molecular formula C21H18ClN5O5 and a molecular weight of 455.86 g/mol. Its IUPAC name is (5Z)-1-(3-chlorophenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(3-chlorophenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 66522422 |
| Molecular Formula | C21H18ClN5O5 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (5Z)-1-(3-chlorophenyl)-5-[(5-nitro-2-piperazin-1-ylphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc(Cl)c2)C(=O)/C1=C\c1cc([N+](=O)[O-])ccc1N1CCNCC1 |
| InChI | InChI=1S/C21H18ClN5O5/c22-14-2-1-3-15(12-14)26-20(29)17(19(28)24-21(26)30)11-13-10-16(27(31)32)4-5-18(13)25-8-6-23-7-9-25/h1-5,10-12,23H,6-9H2,(H,24,28,30)/b17-11- |
| InChIKey | FRRZXNFEYKKKOX-BOPFTXTBSA-N |
| XLogP | 2.32 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|