C23H20ClN5O6 — CID 66522469
(5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 66522469) has the molecular formula C23H20ClN5O6 and a molecular weight of 497.90 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 66522469 |
| Molecular Formula | C23H20ClN5O6 |
| Molecular Weight | 497.90 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-(2-chlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2/C=C2/C(=O)NC(=O)N(c3ccccc3Cl)C2=O)CC1 |
| InChI | InChI=1S/C23H20ClN5O6/c1-14(30)26-8-10-27(11-9-26)19-7-6-16(29(34)35)12-15(19)13-17-21(31)25-23(33)28(22(17)32)20-5-3-2-4-18(20)24/h2-7,12-13H,8-11H2,1H3,(H,25,31,33)/b17-13- |
| InChIKey | DMSJTCCZELRRDS-LGMDPLHJSA-N |
| XLogP | 2.58 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.90 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|