C21H25N5O6 — CID 66522383
(5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-butyl-1,3-diazinane-2,4,6-trione (PubChem CID 66522383) has the molecular formula C21H25N5O6 and a molecular weight of 443.46 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-butyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-butyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 66522383 |
| Molecular Formula | C21H25N5O6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-butyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCN1C(=O)NC(=O)/C(=C/c2cc([N+](=O)[O-])ccc2N2CCN(C(C)=O)CC2)C1=O |
| InChI | InChI=1S/C21H25N5O6/c1-3-4-7-25-20(29)17(19(28)22-21(25)30)13-15-12-16(26(31)32)5-6-18(15)24-10-8-23(9-11-24)14(2)27/h5-6,12-13H,3-4,7-11H2,1-2H3,(H,22,28,30)/b17-13- |
| InChIKey | UVWJSFTXYFUGGD-LGMDPLHJSA-N |
| XLogP | 1.53 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|