C15H16ClN5O4S — CID 66522335
5-[(5-nitro-2-piperazin-4-ium-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione chloride (PubChem CID 66522335) has the molecular formula C15H16ClN5O4S and a molecular weight of 397.84 g/mol. Its IUPAC name is 5-[(5-nitro-2-piperazin-4-ium-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione chloride.
| Compound Name | 5-[(5-nitro-2-piperazin-4-ium-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione chloride |
|---|---|
| PubChem CID | 66522335 |
| Molecular Formula | C15H16ClN5O4S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 5-[(5-nitro-2-piperazin-4-ium-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione chloride |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1cc([N+](=O)[O-])ccc1N1CC[NH2+]CC1.[Cl-] |
| InChI | InChI=1S/C15H15N5O4S.ClH/c21-13-11(14(22)18-15(25)17-13)8-9-7-10(20(23)24)1-2-12(9)19-5-3-16-4-6-19;/h1-2,7-8,16H,3-6H2,(H2,17,18,21,22,25);1H |
| InChIKey | IBBFYRZWECGEBJ-UHFFFAOYSA-N |
| XLogP | -4.10 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|