C29H24N4O6 — CID 126022996
(5Z)-1-(2-methoxyethyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126022996) has the molecular formula C29H24N4O6 and a molecular weight of 524.53 g/mol. Its IUPAC name is (5Z)-1-(2-methoxyethyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(2-methoxyethyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126022996 |
| Molecular Formula | C29H24N4O6 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | (5Z)-1-(2-methoxyethyl)-5-[[1-[(4-nitrophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | COCCN1C(=O)/C(=C/c2cn(Cc3ccc([N+](=O)[O-])cc3)c3ccccc23)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C29H24N4O6/c1-39-16-15-31-27(34)25(28(35)32(29(31)36)22-7-3-2-4-8-22)17-21-19-30(26-10-6-5-9-24(21)26)18-20-11-13-23(14-12-20)33(37)38/h2-14,17,19H,15-16,18H2,1H3/b25-17- |
| InChIKey | SLQLLQSJDALGGS-UQQQWYQISA-N |
| XLogP | 4.62 |
| TPSA | 114.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|