C22H16FN5O5 — CID 2957270
N-(4-fluorophenyl)-2-[3-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]indol-1-yl]acetamide (PubChem CID 2957270) has the molecular formula C22H16FN5O5 and a molecular weight of 449.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]indol-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 2957270 |
| Molecular Formula | C22H16FN5O5 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(C=Cc2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])c2ccccc21)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FN5O5/c23-14-6-8-15(9-7-14)24-19(29)12-27-11-13(16-3-1-2-4-18(16)27)5-10-17-20(28(32)33)21(30)26-22(31)25-17/h1-11H,12H2,(H,24,29)(H2,25,26,30,31) |
| InChIKey | PSDSNDLFWBHJAH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 142.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|