C16H11N5O6 — CID 5185960
5-nitro-6-[2-[1-(4-nitrophenyl)pyrrol-2-yl]ethenyl]-1H-pyrimidine-2,4-dione (PubChem CID 5185960) has the molecular formula C16H11N5O6 and a molecular weight of 369.29 g/mol. Its IUPAC name is 5-nitro-6-[2-[1-(4-nitrophenyl)pyrrol-2-yl]ethenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-nitro-6-[2-[1-(4-nitrophenyl)pyrrol-2-yl]ethenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5185960 |
| Molecular Formula | C16H11N5O6 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 5-nitro-6-[2-[1-(4-nitrophenyl)pyrrol-2-yl]ethenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C=Cc2cccn2-c2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C16H11N5O6/c22-15-14(21(26)27)13(17-16(23)18-15)8-7-10-2-1-9-19(10)11-3-5-12(6-4-11)20(24)25/h1-9H,(H2,17,18,22,23) |
| InChIKey | HZCBMHJLZHGDQR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 156.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|