C19H12N4O8 — CID 3664919
[4-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 4-nitrobenzoate (PubChem CID 3664919) has the molecular formula C19H12N4O8 and a molecular weight of 424.33 g/mol. Its IUPAC name is [4-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 3664919 |
| Molecular Formula | C19H12N4O8 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | [4-[2-(5-nitro-2,4-dioxo-1H-pyrimidin-6-yl)ethenyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc(C=Cc2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H12N4O8/c24-17-16(23(29)30)15(20-19(26)21-17)10-3-11-1-8-14(9-2-11)31-18(25)12-4-6-13(7-5-12)22(27)28/h1-10H,(H2,20,21,24,26) |
| InChIKey | FARNEWLNUWEGII-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|