C18H13N3O5 — CID 2956513
5-nitro-6-[2-(3-phenoxyphenyl)ethenyl]-1H-pyrimidine-2,4-dione (PubChem CID 2956513) has the molecular formula C18H13N3O5 and a molecular weight of 351.32 g/mol. Its IUPAC name is 5-nitro-6-[2-(3-phenoxyphenyl)ethenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-nitro-6-[2-(3-phenoxyphenyl)ethenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2956513 |
| Molecular Formula | C18H13N3O5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 5-nitro-6-[2-(3-phenoxyphenyl)ethenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C=Cc2cccc(Oc3ccccc3)c2)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C18H13N3O5/c22-17-16(21(24)25)15(19-18(23)20-17)10-9-12-5-4-8-14(11-12)26-13-6-2-1-3-7-13/h1-11H,(H2,19,20,22,23) |
| InChIKey | RTCGNVREZYDKKV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|