C14H13N5O6 — CID 3111770
6-[2-[4-(dimethylamino)-3-nitrophenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 3111770) has the molecular formula C14H13N5O6 and a molecular weight of 347.29 g/mol. Its IUPAC name is 6-[2-[4-(dimethylamino)-3-nitrophenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-[4-(dimethylamino)-3-nitrophenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3111770 |
| Molecular Formula | C14H13N5O6 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 6-[2-[4-(dimethylamino)-3-nitrophenyl]ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | CN(C)c1ccc(C=Cc2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N5O6/c1-17(2)10-6-4-8(7-11(10)18(22)23)3-5-9-12(19(24)25)13(20)16-14(21)15-9/h3-7H,1-2H3,(H2,15,16,20,21) |
| InChIKey | NJFFQBWQFZCCND-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|