C12H8N4O7 — CID 3441193
6-[2-(2-hydroxy-3-nitrophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 3441193) has the molecular formula C12H8N4O7 and a molecular weight of 320.22 g/mol. Its IUPAC name is 6-[2-(2-hydroxy-3-nitrophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-(2-hydroxy-3-nitrophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3441193 |
| Molecular Formula | C12H8N4O7 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 6-[2-(2-hydroxy-3-nitrophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C=Cc2cccc([N+](=O)[O-])c2O)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C12H8N4O7/c17-10-6(2-1-3-8(10)15(20)21)4-5-7-9(16(22)23)11(18)14-12(19)13-7/h1-5,17H,(H2,13,14,18,19) |
| InChIKey | NYNJNQUSTXDBEM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 172.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|