C13H8F3N3O4 — CID 6058163
5-nitro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidine-2,4-dione (PubChem CID 6058163) has the molecular formula C13H8F3N3O4 and a molecular weight of 327.22 g/mol. Its IUPAC name is 5-nitro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-nitro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6058163 |
| Molecular Formula | C13H8F3N3O4 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 5-nitro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(/C=C/c2ccccc2C(F)(F)F)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C13H8F3N3O4/c14-13(15,16)8-4-2-1-3-7(8)5-6-9-10(19(22)23)11(20)18-12(21)17-9/h1-6H,(H2,17,18,20,21)/b6-5+ |
| InChIKey | QBNAZRHCNUYBHJ-AATRIKPKSA-N |
| XLogP | 2.16 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|