C30H24ClN3O4 — CID 4548605
ethyl 4-[5-[[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 4548605) has the molecular formula C30H24ClN3O4 and a molecular weight of 525.99 g/mol. Its IUPAC name is ethyl 4-[5-[[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4548605 |
| Molecular Formula | C30H24ClN3O4 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | ethyl 4-[5-[[[1-[(2-chlorophenyl)methyl]indole-3-carbonyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=NNC(=O)c3cn(Cc4ccccc4Cl)c4ccccc34)o2)cc1 |
| InChI | InChI=1S/C30H24ClN3O4/c1-2-37-30(36)21-13-11-20(12-14-21)28-16-15-23(38-28)17-32-33-29(35)25-19-34(27-10-6-4-8-24(25)27)18-22-7-3-5-9-26(22)31/h3-17,19H,2,18H2,1H3,(H,33,35) |
| InChIKey | BVJIAUZOVRWGFF-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|