C19H16N2OS2 — CID 110535661
(Z)-3-(3-propoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 110535661) has the molecular formula C19H16N2OS2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (Z)-3-(3-propoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-propoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110535661 |
| Molecular Formula | C19H16N2OS2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (Z)-3-(3-propoxyphenyl)-2-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCCOc1cccc(/C=C(/C#N)c2nc(-c3cccs3)cs2)c1 |
| InChI | InChI=1S/C19H16N2OS2/c1-2-8-22-16-6-3-5-14(11-16)10-15(12-20)19-21-17(13-24-19)18-7-4-9-23-18/h3-7,9-11,13H,2,8H2,1H3/b15-10- |
| InChIKey | BVFBLZFQGVKOND-GDNBJRDFSA-N |
| XLogP | 5.72 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|