C14H12N2OS — CID 39358185
(E)-3-(3-ethoxyphenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 39358185) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is (E)-3-(3-ethoxyphenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-ethoxyphenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 39358185 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (E)-3-(3-ethoxyphenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCOc1cccc(/C=C(\C#N)c2nccs2)c1 |
| InChI | InChI=1S/C14H12N2OS/c1-2-17-13-5-3-4-11(9-13)8-12(10-15)14-16-6-7-18-14/h3-9H,2H2,1H3/b12-8+ |
| InChIKey | MXXDYGXCBOGBKJ-XYOKQWHBSA-N |
| XLogP | 3.61 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|