C12H7FN2S — CID 39247753
(E)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 39247753) has the molecular formula C12H7FN2S and a molecular weight of 230.27 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 39247753 |
| Molecular Formula | C12H7FN2S |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1F)c1nccs1 |
| InChI | InChI=1S/C12H7FN2S/c13-11-4-2-1-3-9(11)7-10(8-14)12-15-5-6-16-12/h1-7H/b10-7+ |
| InChIKey | CRPVDSFTELALDM-JXMROGBWSA-N |
| XLogP | 3.35 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|