C17H9N3S3 — CID 144792491
(E)-2-(1,3-thiazol-2-yl)-3-[5-[(E)-2-(1,3-thiazol-2-yl)but-1-en-3-ynyl]thiophen-2-yl]prop-2-enenitrile (PubChem CID 144792491) has the molecular formula C17H9N3S3 and a molecular weight of 351.48 g/mol. Its IUPAC name is (E)-2-(1,3-thiazol-2-yl)-3-[5-[(E)-2-(1,3-thiazol-2-yl)but-1-en-3-ynyl]thiophen-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-thiazol-2-yl)-3-[5-[(E)-2-(1,3-thiazol-2-yl)but-1-en-3-ynyl]thiophen-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 144792491 |
| Molecular Formula | C17H9N3S3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | (E)-2-(1,3-thiazol-2-yl)-3-[5-[(E)-2-(1,3-thiazol-2-yl)but-1-en-3-ynyl]thiophen-2-yl]prop-2-enenitrile |
| SMILES | C#C/C(=C\c1ccc(/C=C(\C#N)c2nccs2)s1)c1nccs1 |
| InChI | InChI=1S/C17H9N3S3/c1-2-12(16-19-5-7-21-16)9-14-3-4-15(23-14)10-13(11-18)17-20-6-8-22-17/h1,3-10H/b12-9+,13-10+ |
| InChIKey | YPNIWYOMJYTCSL-JOWSBRCASA-N |
| XLogP | 4.90 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|