C17H23NS2Sn2 — CID 139035212
2,3-bis(5-trimethylstannylthiophen-2-yl)prop-2-enenitrile (PubChem CID 139035212) has the molecular formula C17H23NS2Sn2 and a molecular weight of 542.93 g/mol. Its IUPAC name is 2,3-bis(5-trimethylstannylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | 2,3-bis(5-trimethylstannylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 139035212 |
| Molecular Formula | C17H23NS2Sn2 |
| Molecular Weight | 542.93 g/mol |
| Exact Mass | 544.93 |
| IUPAC Name | 2,3-bis(5-trimethylstannylthiophen-2-yl)prop-2-enenitrile |
| SMILES | C[Sn](C)(C)c1ccc(C=C(C#N)c2ccc([Sn](C)(C)C)s2)s1 |
| InChI | InChI=1S/C11H5NS2.6CH3.2Sn/c12-8-9(11-4-2-6-14-11)7-10-3-1-5-13-10;;;;;;;;/h1-4,7H;6*1H3;; |
| InChIKey | HRRPEYUTGFHQFE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|