C22H11F6N5S — CID 175436826
(Z)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 175436826) has the molecular formula C22H11F6N5S and a molecular weight of 491.42 g/mol. Its IUPAC name is (Z)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 175436826 |
| Molecular Formula | C22H11F6N5S |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | (Z)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/n1nc(-c2ccccc2C(F)(F)F)nc1-c1ccccc1C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C22H11F6N5S/c23-21(24,25)16-7-3-1-5-14(16)18-31-19(15-6-2-4-8-17(15)22(26,27)28)33(32-18)12-13(11-29)20-30-9-10-34-20/h1-10,12H/b13-12- |
| InChIKey | SSPFGZULOMUGOQ-SEYXRHQNSA-N |
| XLogP | 6.63 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|