C26H16F6N6O — CID 175436895
(E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1H-indazol-6-yl)prop-2-enamide (PubChem CID 175436895) has the molecular formula C26H16F6N6O and a molecular weight of 542.44 g/mol. Its IUPAC name is (E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1H-indazol-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1H-indazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 175436895 |
| Molecular Formula | C26H16F6N6O |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | (E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1H-indazol-6-yl)prop-2-enamide |
| SMILES | NC(=O)/C(=C/n1nc(-c2ccccc2C(F)(F)F)nc1-c1ccccc1C(F)(F)F)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C26H16F6N6O/c27-25(28,29)19-7-3-1-5-16(19)23-35-24(17-6-2-4-8-20(17)26(30,31)32)38(37-23)13-18(22(33)39)14-9-10-15-12-34-36-21(15)11-14/h1-13H,(H2,33,39)(H,34,36)/b18-13+ |
| InChIKey | OSCPDGKVODNJJH-QGOAFFKASA-N |
| XLogP | 6.01 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|