C25H14F9N5O — CID 175436818
(E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-[2-(trifluoromethyl)-4-pyridinyl]prop-2-enamide (PubChem CID 175436818) has the molecular formula C25H14F9N5O and a molecular weight of 571.40 g/mol. Its IUPAC name is (E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-[2-(trifluoromethyl)-4-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-[2-(trifluoromethyl)-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 175436818 |
| Molecular Formula | C25H14F9N5O |
| Molecular Weight | 571.40 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | (E)-3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-[2-(trifluoromethyl)-4-pyridinyl]prop-2-enamide |
| SMILES | NC(=O)/C(=C/n1nc(-c2ccccc2C(F)(F)F)nc1-c1ccccc1C(F)(F)F)c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H14F9N5O/c26-23(27,28)17-7-3-1-5-14(17)21-37-22(15-6-2-4-8-18(15)24(29,30)31)39(38-21)12-16(20(35)40)13-9-10-36-19(11-13)25(32,33)34/h1-12H,(H2,35,40)/b16-12+ |
| InChIKey | AOAPYSZZIPZBRV-FOWTUZBSSA-N |
| XLogP | 6.55 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.40 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|