C24H14F7N5O — CID 175436901
3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide (PubChem CID 175436901) has the molecular formula C24H14F7N5O and a molecular weight of 521.40 g/mol. Its IUPAC name is 3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide.
| Compound Name | 3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 175436901 |
| Molecular Formula | C24H14F7N5O |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 3-[3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-fluoro-2-pyridinyl)prop-2-enamide |
| SMILES | NC(=O)C(=Cn1nc(-c2ccccc2C(F)(F)F)nc1-c1ccccc1C(F)(F)F)c1cccc(F)n1 |
| InChI | InChI=1S/C24H14F7N5O/c25-19-11-5-10-18(33-19)15(20(32)37)12-36-22(14-7-2-4-9-17(14)24(29,30)31)34-21(35-36)13-6-1-3-8-16(13)23(26,27)28/h1-12H,(H2,32,37) |
| InChIKey | SQDVVQLOCKPGEO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|