C16H11F3N4O2 — CID 21283770
1-methyl-3-(2-nitrophenyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 21283770) has the molecular formula C16H11F3N4O2 and a molecular weight of 348.28 g/mol. Its IUPAC name is 1-methyl-3-(2-nitrophenyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 1-methyl-3-(2-nitrophenyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 21283770 |
| Molecular Formula | C16H11F3N4O2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-methyl-3-(2-nitrophenyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | Cn1nc(-c2ccccc2[N+](=O)[O-])nc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H11F3N4O2/c1-22-15(10-6-2-4-8-12(10)16(17,18)19)20-14(21-22)11-7-3-5-9-13(11)23(24)25/h2-9H,1H3 |
| InChIKey | RBHWLBXBWMSYSS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|