C23H13F7N6O — CID 175436732
3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide (PubChem CID 175436732) has the molecular formula C23H13F7N6O and a molecular weight of 522.38 g/mol. Its IUPAC name is 3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide.
| Compound Name | 3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 175436732 |
| Molecular Formula | C23H13F7N6O |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-fluoropyrimidin-5-yl)prop-2-enamide |
| SMILES | NC(=O)C(=Cn1nc(-c2ccc(C(F)(F)F)cc2)nc1-c1ccc(C(F)(F)F)cc1)c1cnc(F)nc1 |
| InChI | InChI=1S/C23H13F7N6O/c24-21-32-9-14(10-33-21)17(18(31)37)11-36-20(13-3-7-16(8-4-13)23(28,29)30)34-19(35-36)12-1-5-15(6-2-12)22(25,26)27/h1-11H,(H2,31,37) |
| InChIKey | GJVSDZRSDFNARM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|