C24H13F6N5 — CID 175436877
3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enenitrile (PubChem CID 175436877) has the molecular formula C24H13F6N5 and a molecular weight of 485.39 g/mol. Its IUPAC name is 3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enenitrile.
| Compound Name | 3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 175436877 |
| Molecular Formula | C24H13F6N5 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 3-[3,5-bis[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyridin-3-ylprop-2-enenitrile |
| SMILES | N#CC(=Cn1nc(-c2ccc(C(F)(F)F)cc2)nc1-c1ccc(C(F)(F)F)cc1)c1cccnc1 |
| InChI | InChI=1S/C24H13F6N5/c25-23(26,27)19-7-3-15(4-8-19)21-33-22(16-5-9-20(10-6-16)24(28,29)30)35(34-21)14-18(12-31)17-2-1-11-32-13-17/h1-11,13-14H |
| InChIKey | RMPQWVHDJPNAQH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|