C16H11F3N4S — CID 10831558
(Z)-3-amino-2-cyano-3-pyridin-3-yl-N-[4-(trifluoromethyl)phenyl]prop-2-enethioamide (PubChem CID 10831558) has the molecular formula C16H11F3N4S and a molecular weight of 348.35 g/mol. Its IUPAC name is (Z)-3-amino-2-cyano-3-pyridin-3-yl-N-[4-(trifluoromethyl)phenyl]prop-2-enethioamide.
| Compound Name | (Z)-3-amino-2-cyano-3-pyridin-3-yl-N-[4-(trifluoromethyl)phenyl]prop-2-enethioamide |
|---|---|
| PubChem CID | 10831558 |
| Molecular Formula | C16H11F3N4S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (Z)-3-amino-2-cyano-3-pyridin-3-yl-N-[4-(trifluoromethyl)phenyl]prop-2-enethioamide |
| SMILES | N#C/C(C(=S)Nc1ccc(C(F)(F)F)cc1)=C(/N)c1cccnc1 |
| InChI | InChI=1S/C16H11F3N4S/c17-16(18,19)11-3-5-12(6-4-11)23-15(24)13(8-20)14(21)10-2-1-7-22-9-10/h1-7,9H,21H2,(H,23,24)/b14-13- |
| InChIKey | GIWAYJJOLVKMBJ-YPKPFQOOSA-N |
| XLogP | 3.73 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|