C12H9F3N2NaOS — CID 173306226
CID 173306226 (PubChem CID 173306226) has the molecular formula C12H9F3N2NaOS and a molecular weight of 309.27 g/mol.
| Compound Name | CID 173306226 |
|---|---|
| PubChem CID | 173306226 |
| Molecular Formula | C12H9F3N2NaOS |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | — |
| SMILES | CC(O)=C(C#N)C(=S)Nc1ccc(C(F)(F)F)cc1.[Na] |
| InChI | InChI=1S/C12H9F3N2OS.Na/c1-7(18)10(6-16)11(19)17-9-4-2-8(3-5-9)12(13,14)15;/h2-5,18H,1H3,(H,17,19); |
| InChIKey | DNARTSCXEOGFSI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|