C18H13ClF3N3 — CID 21283809
3-(2-chlorophenyl)-1-prop-2-enyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 21283809) has the molecular formula C18H13ClF3N3 and a molecular weight of 363.77 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-prop-2-enyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 3-(2-chlorophenyl)-1-prop-2-enyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 21283809 |
| Molecular Formula | C18H13ClF3N3 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-(2-chlorophenyl)-1-prop-2-enyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | C=CCn1nc(-c2ccccc2Cl)nc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13ClF3N3/c1-2-11-25-17(12-7-3-5-9-14(12)18(20,21)22)23-16(24-25)13-8-4-6-10-15(13)19/h2-10H,1,11H2 |
| InChIKey | LRIQXJVXTVOJME-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|