C19H14N4OS — CID 52747125
N-[4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]phenyl]acetamide (PubChem CID 52747125) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is N-[4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 52747125 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C(/C#N)c2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C19H14N4OS/c1-13(24)22-17-4-2-14(3-5-17)10-16(11-20)19-23-18(12-25-19)15-6-8-21-9-7-15/h2-10,12H,1H3,(H,22,24)/b16-10- |
| InChIKey | ODFJDAUAZTWEEO-YBEGLDIGSA-N |
| XLogP | 4.23 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|