C18H10N4S — CID 52747155
4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]benzonitrile (PubChem CID 52747155) has the molecular formula C18H10N4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]benzonitrile.
| Compound Name | 4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 52747155 |
| Molecular Formula | C18H10N4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-[(Z)-2-cyano-2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethenyl]benzonitrile |
| SMILES | N#C/C(=C/c1ccc(C#N)cc1)c1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C18H10N4S/c19-10-14-3-1-13(2-4-14)9-16(11-20)18-22-17(12-23-18)15-5-7-21-8-6-15/h1-9,12H/b16-9- |
| InChIKey | WGZVDAVVALKXEC-SXGWCWSVSA-N |
| XLogP | 4.14 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|