C22H15N3OS2 — CID 25481598
(E)-2-(4-phenyl-1,3-thiazol-2-yl)-3-[4-(1,3-thiazol-4-ylmethoxy)phenyl]prop-2-enenitrile (PubChem CID 25481598) has the molecular formula C22H15N3OS2 and a molecular weight of 401.52 g/mol. Its IUPAC name is (E)-2-(4-phenyl-1,3-thiazol-2-yl)-3-[4-(1,3-thiazol-4-ylmethoxy)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(4-phenyl-1,3-thiazol-2-yl)-3-[4-(1,3-thiazol-4-ylmethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 25481598 |
| Molecular Formula | C22H15N3OS2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (E)-2-(4-phenyl-1,3-thiazol-2-yl)-3-[4-(1,3-thiazol-4-ylmethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(OCc2cscn2)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H15N3OS2/c23-11-18(22-25-21(14-28-22)17-4-2-1-3-5-17)10-16-6-8-20(9-7-16)26-12-19-13-27-15-24-19/h1-10,13-15H,12H2/b18-10+ |
| InChIKey | VDAXQYDFEBJQFX-VCHYOVAHSA-N |
| XLogP | 5.91 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|