C15H19N5O2S — CID 8812614
N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(2-oxoazepan-1-yl)acetohydrazide (PubChem CID 8812614) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(2-oxoazepan-1-yl)acetohydrazide.
| Compound Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(2-oxoazepan-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 8812614 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(2-oxoazepan-1-yl)acetohydrazide |
| SMILES | Cc1csc(/C(C#N)=C/NNC(=O)CN2CCCCCC2=O)n1 |
| InChI | InChI=1S/C15H19N5O2S/c1-11-10-23-15(18-11)12(7-16)8-17-19-13(21)9-20-6-4-2-3-5-14(20)22/h8,10,17H,2-6,9H2,1H3,(H,19,21)/b12-8+ |
| InChIKey | AHRQVYGKZONSAC-XYOKQWHBSA-N |
| XLogP | 1.34 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|