C20H24N4OS2 — CID 8812227
(5S)-5-tert-butyl-N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 8812227) has the molecular formula C20H24N4OS2 and a molecular weight of 400.57 g/mol. Its IUPAC name is (5S)-5-tert-butyl-N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5S)-5-tert-butyl-N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 8812227 |
| Molecular Formula | C20H24N4OS2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (5S)-5-tert-butyl-N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | Cc1csc(/C(C#N)=C/NNC(=O)c2cc3c(s2)CC[C@H](C(C)(C)C)C3)n1 |
| InChI | InChI=1S/C20H24N4OS2/c1-12-11-26-19(23-12)14(9-21)10-22-24-18(25)17-8-13-7-15(20(2,3)4)5-6-16(13)27-17/h8,10-11,15,22H,5-7H2,1-4H3,(H,24,25)/b14-10+/t15-/m0/s1 |
| InChIKey | SOTNJLMOFDVFKX-IPJDOKCGSA-N |
| XLogP | 4.46 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|