C20H24F3N3O — CID 99845654
1-[(4aR,8R,8aS)-8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone (PubChem CID 99845654) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is 1-[(4aR,8R,8aS)-8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone.
| Compound Name | 1-[(4aR,8R,8aS)-8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 99845654 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[(4aR,8R,8aS)-8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone |
| SMILES | C[C@@H]1CCC[C@@H]2CCCN(C(=O)Cn3c(C(F)(F)F)nc4ccccc43)[C@H]21 |
| InChI | InChI=1S/C20H24F3N3O/c1-13-6-4-7-14-8-5-11-25(18(13)14)17(27)12-26-16-10-3-2-9-15(16)24-19(26)20(21,22)23/h2-3,9-10,13-14,18H,4-8,11-12H2,1H3/t13-,14-,18+/m1/s1 |
| InChIKey | BDPKJFSLBSZPBD-LBTNJELSSA-N |
| XLogP | 4.48 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |